About (Z)-3-N-ethylidenepent-2-ene-1,3-diimine
(Z)-3-N-ethylidenepent-2-ene-1,3-diimine (PubChem CID 118889253) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is (Z)-3-N-ethylidenepent-2-ene-1,3-diimine.
Molecular Properties
| Compound Name | (Z)-3-N-ethylidenepent-2-ene-1,3-diimine |
| PubChem CID | 118889253 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | (Z)-3-N-ethylidenepent-2-ene-1,3-diimine |
| SMILES | [H]/N=C/C=C(CC)\N=C\C |
| InChI | InChI=1S/C7H12N2/c1-3-7(5-6-8)9-4-2/h4-6,8H,3H2,1-2H3/b7-5-,8-6+,9-4+ |
| InChIKey | ZZVKWYDADOTHQF-JOVNBEPESA-N |
| XLogP | 2.02 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-N-ethylidenepent-2-ene-1,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-N-ethylidenepent-2-ene-1,3-diimine?
The IUPAC name of (Z)-3-N-ethylidenepent-2-ene-1,3-diimine (CID 118889253) is (Z)-3-N-ethylidenepent-2-ene-1,3-diimine.
What is the SMILES notation for (Z)-3-N-ethylidenepent-2-ene-1,3-diimine?
The canonical SMILES for (Z)-3-N-ethylidenepent-2-ene-1,3-diimine is [H]/N=C/C=C(CC)\N=C\C.
What is the InChIKey of (Z)-3-N-ethylidenepent-2-ene-1,3-diimine?
The InChIKey is ZZVKWYDADOTHQF-JOVNBEPESA-N. The full InChI is InChI=1S/C7H12N2/c1-3-7(5-6-8)9-4-2/h4-6,8H,3H2,1-2H3/b7-5-,8-6+,9-4+.
What are the key properties of (Z)-3-N-ethylidenepent-2-ene-1,3-diimine?
(Z)-3-N-ethylidenepent-2-ene-1,3-diimine has a molecular weight of 124.19 g/mol, XLogP of 2.02, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-N-ethylidenepent-2-ene-1,3-diimine is sourced from PubChem (CID 118889253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).