About (4S)-N,N,4-triethyl-6-methoxyhexan-1-amine
(4S)-N,N,4-triethyl-6-methoxyhexan-1-amine (PubChem CID 118889996) has the molecular formula C13H29NO
and a molecular weight of 215.38 g/mol. Its IUPAC name is (4S)-N,N,4-triethyl-6-methoxyhexan-1-amine.
Molecular Properties
| Compound Name | (4S)-N,N,4-triethyl-6-methoxyhexan-1-amine |
| PubChem CID | 118889996 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | (4S)-N,N,4-triethyl-6-methoxyhexan-1-amine |
| SMILES | CC[C@@H](CCCN(CC)CC)CCOC |
| InChI | InChI=1S/C13H29NO/c1-5-13(10-12-15-4)9-8-11-14(6-2)7-3/h13H,5-12H2,1-4H3/t13-/m0/s1 |
| InChIKey | HHFADWQIAJVDCL-ZDUSSCGKSA-N |
| XLogP | 3.17 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-N,N,4-triethyl-6-methoxyhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-N,N,4-triethyl-6-methoxyhexan-1-amine?
The IUPAC name of (4S)-N,N,4-triethyl-6-methoxyhexan-1-amine (CID 118889996) is (4S)-N,N,4-triethyl-6-methoxyhexan-1-amine.
What is the SMILES notation for (4S)-N,N,4-triethyl-6-methoxyhexan-1-amine?
The canonical SMILES for (4S)-N,N,4-triethyl-6-methoxyhexan-1-amine is CC[C@@H](CCCN(CC)CC)CCOC.
What is the InChIKey of (4S)-N,N,4-triethyl-6-methoxyhexan-1-amine?
The InChIKey is HHFADWQIAJVDCL-ZDUSSCGKSA-N. The full InChI is InChI=1S/C13H29NO/c1-5-13(10-12-15-4)9-8-11-14(6-2)7-3/h13H,5-12H2,1-4H3/t13-/m0/s1.
What are the key properties of (4S)-N,N,4-triethyl-6-methoxyhexan-1-amine?
(4S)-N,N,4-triethyl-6-methoxyhexan-1-amine has a molecular weight of 215.38 g/mol, XLogP of 3.17, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-N,N,4-triethyl-6-methoxyhexan-1-amine is sourced from PubChem (CID 118889996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).