About (4R)-4-ethyl-6-methoxy-N,N-dimethylhexan-1-amine
(4R)-4-ethyl-6-methoxy-N,N-dimethylhexan-1-amine (PubChem CID 118890168) has the molecular formula C11H25NO
and a molecular weight of 187.33 g/mol. Its IUPAC name is (4R)-4-ethyl-6-methoxy-N,N-dimethylhexan-1-amine.
Molecular Properties
| Compound Name | (4R)-4-ethyl-6-methoxy-N,N-dimethylhexan-1-amine |
| PubChem CID | 118890168 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | (4R)-4-ethyl-6-methoxy-N,N-dimethylhexan-1-amine |
| SMILES | CC[C@H](CCCN(C)C)CCOC |
| InChI | InChI=1S/C11H25NO/c1-5-11(8-10-13-4)7-6-9-12(2)3/h11H,5-10H2,1-4H3/t11-/m1/s1 |
| InChIKey | MHPSNIQJQWAUDX-LLVKDONJSA-N |
| XLogP | 2.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-4-ethyl-6-methoxy-N,N-dimethylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-ethyl-6-methoxy-N,N-dimethylhexan-1-amine?
The IUPAC name of (4R)-4-ethyl-6-methoxy-N,N-dimethylhexan-1-amine (CID 118890168) is (4R)-4-ethyl-6-methoxy-N,N-dimethylhexan-1-amine.
What is the SMILES notation for (4R)-4-ethyl-6-methoxy-N,N-dimethylhexan-1-amine?
The canonical SMILES for (4R)-4-ethyl-6-methoxy-N,N-dimethylhexan-1-amine is CC[C@H](CCCN(C)C)CCOC.
What is the InChIKey of (4R)-4-ethyl-6-methoxy-N,N-dimethylhexan-1-amine?
The InChIKey is MHPSNIQJQWAUDX-LLVKDONJSA-N. The full InChI is InChI=1S/C11H25NO/c1-5-11(8-10-13-4)7-6-9-12(2)3/h11H,5-10H2,1-4H3/t11-/m1/s1.
What are the key properties of (4R)-4-ethyl-6-methoxy-N,N-dimethylhexan-1-amine?
(4R)-4-ethyl-6-methoxy-N,N-dimethylhexan-1-amine has a molecular weight of 187.33 g/mol, XLogP of 2.39, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-ethyl-6-methoxy-N,N-dimethylhexan-1-amine is sourced from PubChem (CID 118890168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).