About (4S)-N-(2,2-dimethylpropyl)-4-(methoxymethyl)heptan-1-amine
(4S)-N-(2,2-dimethylpropyl)-4-(methoxymethyl)heptan-1-amine (PubChem CID 118890171) has the molecular formula C14H31NO
and a molecular weight of 229.41 g/mol. Its IUPAC name is (4S)-N-(2,2-dimethylpropyl)-4-(methoxymethyl)heptan-1-amine.
Molecular Properties
| Compound Name | (4S)-N-(2,2-dimethylpropyl)-4-(methoxymethyl)heptan-1-amine |
| PubChem CID | 118890171 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | (4S)-N-(2,2-dimethylpropyl)-4-(methoxymethyl)heptan-1-amine |
| SMILES | CCC[C@@H](CCCNCC(C)(C)C)COC |
| InChI | InChI=1S/C14H31NO/c1-6-8-13(11-16-5)9-7-10-15-12-14(2,3)4/h13,15H,6-12H2,1-5H3/t13-/m0/s1 |
| InChIKey | OPWXRMTYLWNRJL-ZDUSSCGKSA-N |
| XLogP | 3.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4S)-N-(2,2-dimethylpropyl)-4-(methoxymethyl)heptan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-N-(2,2-dimethylpropyl)-4-(methoxymethyl)heptan-1-amine?
The IUPAC name of (4S)-N-(2,2-dimethylpropyl)-4-(methoxymethyl)heptan-1-amine (CID 118890171) is (4S)-N-(2,2-dimethylpropyl)-4-(methoxymethyl)heptan-1-amine.
What is the SMILES notation for (4S)-N-(2,2-dimethylpropyl)-4-(methoxymethyl)heptan-1-amine?
The canonical SMILES for (4S)-N-(2,2-dimethylpropyl)-4-(methoxymethyl)heptan-1-amine is CCC[C@@H](CCCNCC(C)(C)C)COC.
What is the InChIKey of (4S)-N-(2,2-dimethylpropyl)-4-(methoxymethyl)heptan-1-amine?
The InChIKey is OPWXRMTYLWNRJL-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H31NO/c1-6-8-13(11-16-5)9-7-10-15-12-14(2,3)4/h13,15H,6-12H2,1-5H3/t13-/m0/s1.
What are the key properties of (4S)-N-(2,2-dimethylpropyl)-4-(methoxymethyl)heptan-1-amine?
(4S)-N-(2,2-dimethylpropyl)-4-(methoxymethyl)heptan-1-amine has a molecular weight of 229.41 g/mol, XLogP of 3.46, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-N-(2,2-dimethylpropyl)-4-(methoxymethyl)heptan-1-amine is sourced from PubChem (CID 118890171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).