C25H43N3 — CID 118890333
N'-methyl-N-[(2E,4E)-4-methylhepta-2,4,6-trien-3-yl]-N'-[4-[[(2E,4E)-4-methylhepta-2,4,6-trien-3-yl]amino]butyl]butane-1,4-diamine (PubChem CID 118890333) has the molecular formula C25H43N3 and a molecular weight of 385.64 g/mol. Its IUPAC name is N'-methyl-N-[(2E,4E)-4-methylhepta-2,4,6-trien-3-yl]-N'-[4-[[(2E,4E)-4-methylhepta-2,4,6-trien-3-yl]amino]butyl]butane-1,4-diamine.
| Compound Name | N'-methyl-N-[(2E,4E)-4-methylhepta-2,4,6-trien-3-yl]-N'-[4-[[(2E,4E)-4-methylhepta-2,4,6-trien-3-yl]amino]butyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 118890333 |
| Molecular Formula | C25H43N3 |
| Molecular Weight | 385.64 g/mol |
| Exact Mass | 385.35 |
| IUPAC Name | N'-methyl-N-[(2E,4E)-4-methylhepta-2,4,6-trien-3-yl]-N'-[4-[[(2E,4E)-4-methylhepta-2,4,6-trien-3-yl]amino]butyl]butane-1,4-diamine |
| SMILES | C=C/C=C(C)/C(=C\C)NCCCCN(C)CCCCNC(=C/C)/C(C)=C/C=C |
| InChI | InChI=1S/C25H43N3/c1-8-16-22(5)24(10-3)26-18-12-14-20-28(7)21-15-13-19-27-25(11-4)23(6)17-9-2/h8-11,16-17,26-27H,1-2,12-15,18-21H2,3-7H3/b22-16+,23-17+,24-10+,25-11+ |
| InChIKey | ZEMAWDLNLLILDC-YXLPSRMUSA-N |
| XLogP | 5.73 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.64 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|