C45H46N8O5 — CID 118890750
3',6'-bis(dimethylamino)-N-[4-[[2-(1H-indol-4-yl)-6-morpholin-4-ylpyrimidin-4-yl]amino]butyl]-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide (PubChem CID 118890750) has the molecular formula C45H46N8O5 and a molecular weight of 778.91 g/mol. Its IUPAC name is 3',6'-bis(dimethylamino)-N-[4-[[2-(1H-indol-4-yl)-6-morpholin-4-ylpyrimidin-4-yl]amino]butyl]-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide.
| Compound Name | 3',6'-bis(dimethylamino)-N-[4-[[2-(1H-indol-4-yl)-6-morpholin-4-ylpyrimidin-4-yl]amino]butyl]-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide |
|---|---|
| PubChem CID | 118890750 |
| Molecular Formula | C45H46N8O5 |
| Molecular Weight | 778.91 g/mol |
| Exact Mass | 778.36 |
| IUPAC Name | 3',6'-bis(dimethylamino)-N-[4-[[2-(1H-indol-4-yl)-6-morpholin-4-ylpyrimidin-4-yl]amino]butyl]-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide |
| SMILES | CN(C)c1ccc2c(c1)Oc1cc(N(C)C)ccc1C21OC(=O)c2ccc(C(=O)NCCCCNc3cc(N4CCOCC4)nc(-c4cccc5[nH]ccc45)n3)cc21 |
| InChI | InChI=1S/C45H46N8O5/c1-51(2)29-11-14-34-38(25-29)57-39-26-30(52(3)4)12-15-35(39)45(34)36-24-28(10-13-33(36)44(55)58-45)43(54)48-18-6-5-17-47-40-27-41(53-20-22-56-23-21-53)50-42(49-40)32-8-7-9-37-31(32)16-19-46-37/h7-16,19,24-27,46H,5-6,17-18,20-23H2,1-4H3,(H,48,54)(H,47,49,50) |
| InChIKey | ZGEPTOGLQRZURK-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 137.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.91 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|