C9H16FN5 — CID 118890836
3-fluoro-N,N'-dimethyl-N-[(1-methyltriazol-4-yl)methyl]propanimidamide (PubChem CID 118890836) has the molecular formula C9H16FN5 and a molecular weight of 213.26 g/mol. Its IUPAC name is 3-fluoro-N,N'-dimethyl-N-[(1-methyltriazol-4-yl)methyl]propanimidamide.
| Compound Name | 3-fluoro-N,N'-dimethyl-N-[(1-methyltriazol-4-yl)methyl]propanimidamide |
|---|---|
| PubChem CID | 118890836 |
| Molecular Formula | C9H16FN5 |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 3-fluoro-N,N'-dimethyl-N-[(1-methyltriazol-4-yl)methyl]propanimidamide |
| SMILES | C/N=C(\CCF)N(C)Cc1cn(C)nn1 |
| InChI | InChI=1S/C9H16FN5/c1-11-9(4-5-10)14(2)6-8-7-15(3)13-12-8/h7H,4-6H2,1-3H3/b11-9+ |
| InChIKey | AGDBMCOLTXGNCF-PKNBQFBNSA-N |
| XLogP | 0.63 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|