C15H20F3N3O5 — CID 118890984
tert-butyl N-[2-[[3-(2,5-dioxopyrrol-1-yl)-4,4,4-trifluorobutanoyl]amino]ethyl]carbamate (PubChem CID 118890984) has the molecular formula C15H20F3N3O5 and a molecular weight of 379.34 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-(2,5-dioxopyrrol-1-yl)-4,4,4-trifluorobutanoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-(2,5-dioxopyrrol-1-yl)-4,4,4-trifluorobutanoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 118890984 |
| Molecular Formula | C15H20F3N3O5 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | tert-butyl N-[2-[[3-(2,5-dioxopyrrol-1-yl)-4,4,4-trifluorobutanoyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)CC(N1C(=O)C=CC1=O)C(F)(F)F |
| InChI | InChI=1S/C15H20F3N3O5/c1-14(2,3)26-13(25)20-7-6-19-10(22)8-9(15(16,17)18)21-11(23)4-5-12(21)24/h4-5,9H,6-8H2,1-3H3,(H,19,22)(H,20,25) |
| InChIKey | BJTUHFLHXBEONE-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|