About 2-aminoethyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]-dimethylazanium
2-aminoethyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]-dimethylazanium (PubChem CID 118890991) has the molecular formula C10H18N3O2+
and a molecular weight of 212.27 g/mol. Its IUPAC name is 2-aminoethyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]-dimethylazanium.
Molecular Properties
| Compound Name | 2-aminoethyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]-dimethylazanium |
| PubChem CID | 118890991 |
| Molecular Formula | C10H18N3O2+ |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 2-aminoethyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]-dimethylazanium |
| SMILES | C[N+](C)(CCN)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H18N3O2/c1-13(2,7-5-11)8-6-12-9(14)3-4-10(12)15/h3-4H,5-8,11H2,1-2H3/q+1 |
| InChIKey | ONGUSQBKDIGSKU-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]-dimethylazanium?
The IUPAC name of 2-aminoethyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]-dimethylazanium (CID 118890991) is 2-aminoethyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]-dimethylazanium.
What is the SMILES notation for 2-aminoethyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]-dimethylazanium?
The canonical SMILES for 2-aminoethyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]-dimethylazanium is C[N+](C)(CCN)CCN1C(=O)C=CC1=O.
What is the InChIKey of 2-aminoethyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]-dimethylazanium?
The InChIKey is ONGUSQBKDIGSKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N3O2/c1-13(2,7-5-11)8-6-12-9(14)3-4-10(12)15/h3-4H,5-8,11H2,1-2H3/q+1.
What are the key properties of 2-aminoethyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]-dimethylazanium?
2-aminoethyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]-dimethylazanium has a molecular weight of 212.27 g/mol, XLogP of -1.05, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]-dimethylazanium is sourced from PubChem (CID 118890991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).