C22H29NO4P+ — CID 11889255
(1R,2S,4R,5S)-9-dimethoxyphosphoryl-2,4-diphenyl-3-azoniabicyclo[3.3.1]nonan-9-ol (PubChem CID 11889255) has the molecular formula C22H29NO4P+ and a molecular weight of 402.45 g/mol. Its IUPAC name is (1R,2S,4R,5S)-9-dimethoxyphosphoryl-2,4-diphenyl-3-azoniabicyclo[3.3.1]nonan-9-ol.
| Compound Name | (1R,2S,4R,5S)-9-dimethoxyphosphoryl-2,4-diphenyl-3-azoniabicyclo[3.3.1]nonan-9-ol |
|---|---|
| PubChem CID | 11889255 |
| Molecular Formula | C22H29NO4P+ |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (1R,2S,4R,5S)-9-dimethoxyphosphoryl-2,4-diphenyl-3-azoniabicyclo[3.3.1]nonan-9-ol |
| SMILES | COP(=O)(OC)C1(O)[C@@H]2CCC[C@H]1[C@H](c1ccccc1)[NH2+][C@@H]2c1ccccc1 |
| InChI | InChI=1S/C22H28NO4P/c1-26-28(25,27-2)22(24)18-14-9-15-19(22)21(17-12-7-4-8-13-17)23-20(18)16-10-5-3-6-11-16/h3-8,10-13,18-21,23-24H,9,14-15H2,1-2H3/p+1/t18-,19+,20-,21+,22? |
| InChIKey | FVURVDZRDOAWTJ-SROUJUHQSA-O |
| XLogP | 3.64 |
| TPSA | 72.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|