C17H29NO2 — CID 118892625
[(2E,6E)-6-methylnona-2,6,8-trienyl] N,N-di(propan-2-yl)carbamate (PubChem CID 118892625) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is [(2E,6E)-6-methylnona-2,6,8-trienyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(2E,6E)-6-methylnona-2,6,8-trienyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 118892625 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | [(2E,6E)-6-methylnona-2,6,8-trienyl] N,N-di(propan-2-yl)carbamate |
| SMILES | C=C/C=C(\C)CC/C=C/COC(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C17H29NO2/c1-7-11-16(6)12-9-8-10-13-20-17(19)18(14(2)3)15(4)5/h7-8,10-11,14-15H,1,9,12-13H2,2-6H3/b10-8+,16-11+ |
| InChIKey | QNWHNPADGVLRCP-MDZLNXBVSA-N |
| XLogP | 4.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|