C14H17N6+ — CID 118893364
4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-N-ethyl-N-ethynylaniline (PubChem CID 118893364) has the molecular formula C14H17N6+ and a molecular weight of 269.33 g/mol. Its IUPAC name is 4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-N-ethyl-N-ethynylaniline.
| Compound Name | 4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-N-ethyl-N-ethynylaniline |
|---|---|
| PubChem CID | 118893364 |
| Molecular Formula | C14H17N6+ |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-N-ethyl-N-ethynylaniline |
| SMILES | C#CN(CC)c1ccc(/N=N/c2n(C)nc[n+]2C)cc1 |
| InChI | InChI=1S/C14H17N6/c1-5-20(6-2)13-9-7-12(8-10-13)16-17-14-18(3)11-15-19(14)4/h1,7-11H,6H2,2-4H3/q+1 |
| InChIKey | PUCWKIJHNHUCAR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 49.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|