C19H22F6O8 — CID 118893808
5-O-[2-(2-methylprop-2-enoyloxy)ethyl] 1-O,3-O-bis(2,2,2-trifluoroethyl) cyclohexane-1,3,5-tricarboxylate (PubChem CID 118893808) has the molecular formula C19H22F6O8 and a molecular weight of 492.37 g/mol. Its IUPAC name is 5-O-[2-(2-methylprop-2-enoyloxy)ethyl] 1-O,3-O-bis(2,2,2-trifluoroethyl) cyclohexane-1,3,5-tricarboxylate.
| Compound Name | 5-O-[2-(2-methylprop-2-enoyloxy)ethyl] 1-O,3-O-bis(2,2,2-trifluoroethyl) cyclohexane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 118893808 |
| Molecular Formula | C19H22F6O8 |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 5-O-[2-(2-methylprop-2-enoyloxy)ethyl] 1-O,3-O-bis(2,2,2-trifluoroethyl) cyclohexane-1,3,5-tricarboxylate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C1CC(C(=O)OCC(F)(F)F)CC(C(=O)OCC(F)(F)F)C1 |
| InChI | InChI=1S/C19H22F6O8/c1-10(2)14(26)30-3-4-31-15(27)11-5-12(16(28)32-8-18(20,21)22)7-13(6-11)17(29)33-9-19(23,24)25/h11-13H,1,3-9H2,2H3 |
| InChIKey | BYWZUEDWTWRMHW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|