C21H23F9O8 — CID 118893818
3-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 5-O-[2-(2-methylprop-2-enoyloxy)ethyl] 1-O-(1,1,1-trifluoropropan-2-yl) cyclohexane-1,3,5-tricarboxylate (PubChem CID 118893818) has the molecular formula C21H23F9O8 and a molecular weight of 574.39 g/mol. Its IUPAC name is 3-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 5-O-[2-(2-methylprop-2-enoyloxy)ethyl] 1-O-(1,1,1-trifluoropropan-2-yl) cyclohexane-1,3,5-tricarboxylate.
| Compound Name | 3-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 5-O-[2-(2-methylprop-2-enoyloxy)ethyl] 1-O-(1,1,1-trifluoropropan-2-yl) cyclohexane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 118893818 |
| Molecular Formula | C21H23F9O8 |
| Molecular Weight | 574.39 g/mol |
| Exact Mass | 574.12 |
| IUPAC Name | 3-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 5-O-[2-(2-methylprop-2-enoyloxy)ethyl] 1-O-(1,1,1-trifluoropropan-2-yl) cyclohexane-1,3,5-tricarboxylate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C1CC(C(=O)OC(C)C(F)(F)F)CC(C(=O)OC(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C21H23F9O8/c1-9(2)14(31)35-4-5-36-15(32)11-6-12(16(33)37-10(3)19(22,23)24)8-13(7-11)17(34)38-18(20(25,26)27)21(28,29)30/h10-13,18H,1,4-8H2,2-3H3 |
| InChIKey | YDEJEPCXXLVQLF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|