C25H30N2O2S — CID 118894143
O-[3-methoxy-5,6-di(propan-2-yl)-5,6,7,8-tetrahydronaphthalen-2-yl] benzimidazole-1-carbothioate (PubChem CID 118894143) has the molecular formula C25H30N2O2S and a molecular weight of 422.59 g/mol. Its IUPAC name is O-[3-methoxy-5,6-di(propan-2-yl)-5,6,7,8-tetrahydronaphthalen-2-yl] benzimidazole-1-carbothioate.
| Compound Name | O-[3-methoxy-5,6-di(propan-2-yl)-5,6,7,8-tetrahydronaphthalen-2-yl] benzimidazole-1-carbothioate |
|---|---|
| PubChem CID | 118894143 |
| Molecular Formula | C25H30N2O2S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | O-[3-methoxy-5,6-di(propan-2-yl)-5,6,7,8-tetrahydronaphthalen-2-yl] benzimidazole-1-carbothioate |
| SMILES | COc1cc2c(cc1OC(=S)n1cnc3ccccc31)CCC(C(C)C)C2C(C)C |
| InChI | InChI=1S/C25H30N2O2S/c1-15(2)18-11-10-17-12-23(22(28-5)13-19(17)24(18)16(3)4)29-25(30)27-14-26-20-8-6-7-9-21(20)27/h6-9,12-16,18,24H,10-11H2,1-5H3 |
| InChIKey | KKLWUHRUZPDMBW-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|