About 1-methoxyethyl N-methylcarbamate
1-methoxyethyl N-methylcarbamate (PubChem CID 118894372) has the molecular formula C5H11NO3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 1-methoxyethyl N-methylcarbamate.
Molecular Properties
| Compound Name | 1-methoxyethyl N-methylcarbamate |
| PubChem CID | 118894372 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | 1-methoxyethyl N-methylcarbamate |
| SMILES | CNC(=O)OC(C)OC |
| InChI | InChI=1S/C5H11NO3/c1-4(8-3)9-5(7)6-2/h4H,1-3H3,(H,6,7) |
| InChIKey | IQTADDJOFGWURZ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxyethyl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxyethyl N-methylcarbamate?
The IUPAC name of 1-methoxyethyl N-methylcarbamate (CID 118894372) is 1-methoxyethyl N-methylcarbamate.
What is the SMILES notation for 1-methoxyethyl N-methylcarbamate?
The canonical SMILES for 1-methoxyethyl N-methylcarbamate is CNC(=O)OC(C)OC.
What is the InChIKey of 1-methoxyethyl N-methylcarbamate?
The InChIKey is IQTADDJOFGWURZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO3/c1-4(8-3)9-5(7)6-2/h4H,1-3H3,(H,6,7).
What are the key properties of 1-methoxyethyl N-methylcarbamate?
1-methoxyethyl N-methylcarbamate has a molecular weight of 133.15 g/mol, XLogP of 0.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxyethyl N-methylcarbamate is sourced from PubChem (CID 118894372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).