C27H39FO16 — CID 118894783
[(2R,3R,4S,5S,6S)-4-acetyloxy-6-(2-fluoroethoxy)-3-methyl-5-[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 118894783) has the molecular formula C27H39FO16 and a molecular weight of 638.59 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-4-acetyloxy-6-(2-fluoroethoxy)-3-methyl-5-[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-4-acetyloxy-6-(2-fluoroethoxy)-3-methyl-5-[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 118894783 |
| Molecular Formula | C27H39FO16 |
| Molecular Weight | 638.59 g/mol |
| Exact Mass | 638.22 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-4-acetyloxy-6-(2-fluoroethoxy)-3-methyl-5-[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](OCCF)[C@@H](O[C@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]2OC(C)=O)[C@@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C27H39FO16/c1-12-19(10-36-13(2)29)42-26(35-9-8-28)24(21(12)38-15(4)31)44-27-25(41-18(7)34)23(40-17(6)33)22(39-16(5)32)20(43-27)11-37-14(3)30/h12,19-27H,8-11H2,1-7H3/t12-,19+,20-,21+,22-,23+,24+,25+,26+,27-/m1/s1 |
| InChIKey | PNTLQKPYKMNXAK-NVJPLZJYSA-N |
| XLogP | 0.30 |
| TPSA | 194.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.59 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|