C18H17NO5 — CID 118895001
1-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)propan-2-yl benzoate (PubChem CID 118895001) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is 1-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)propan-2-yl benzoate.
| Compound Name | 1-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)propan-2-yl benzoate |
|---|---|
| PubChem CID | 118895001 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 1-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)propan-2-yl benzoate |
| SMILES | CC(CN1C(=O)C2C3C=CC(O3)C2C1=O)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H17NO5/c1-10(23-18(22)11-5-3-2-4-6-11)9-19-16(20)14-12-7-8-13(24-12)15(14)17(19)21/h2-8,10,12-15H,9H2,1H3 |
| InChIKey | QRWTVCBSUACKCL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|