C17H17NO5 — CID 118895036
2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)ethyl benzoate (PubChem CID 118895036) has the molecular formula C17H17NO5 and a molecular weight of 315.32 g/mol. Its IUPAC name is 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)ethyl benzoate.
| Compound Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)ethyl benzoate |
|---|---|
| PubChem CID | 118895036 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)ethyl benzoate |
| SMILES | O=C(OCCN1C(=O)C2C3CCC(O3)C2C1=O)c1ccccc1 |
| InChI | InChI=1S/C17H17NO5/c19-15-13-11-6-7-12(23-11)14(13)16(20)18(15)8-9-22-17(21)10-4-2-1-3-5-10/h1-5,11-14H,6-9H2 |
| InChIKey | FKRDIFIMPFYXQD-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|