About N-methyl-4-phenyl-1,2-oxazol-5-amine
N-methyl-4-phenyl-1,2-oxazol-5-amine (PubChem CID 118895094) has the molecular formula C10H10N2O
and a molecular weight of 174.20 g/mol. Its IUPAC name is N-methyl-4-phenyl-1,2-oxazol-5-amine.
Molecular Properties
| Compound Name | N-methyl-4-phenyl-1,2-oxazol-5-amine |
| PubChem CID | 118895094 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | N-methyl-4-phenyl-1,2-oxazol-5-amine |
| SMILES | CNc1oncc1-c1ccccc1 |
| InChI | InChI=1S/C10H10N2O/c1-11-10-9(7-12-13-10)8-5-3-2-4-6-8/h2-7,11H,1H3 |
| InChIKey | BZXSEQMCSSFOIZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-4-phenyl-1,2-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-4-phenyl-1,2-oxazol-5-amine?
The IUPAC name of N-methyl-4-phenyl-1,2-oxazol-5-amine (CID 118895094) is N-methyl-4-phenyl-1,2-oxazol-5-amine.
What is the SMILES notation for N-methyl-4-phenyl-1,2-oxazol-5-amine?
The canonical SMILES for N-methyl-4-phenyl-1,2-oxazol-5-amine is CNc1oncc1-c1ccccc1.
What is the InChIKey of N-methyl-4-phenyl-1,2-oxazol-5-amine?
The InChIKey is BZXSEQMCSSFOIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O/c1-11-10-9(7-12-13-10)8-5-3-2-4-6-8/h2-7,11H,1H3.
What are the key properties of N-methyl-4-phenyl-1,2-oxazol-5-amine?
N-methyl-4-phenyl-1,2-oxazol-5-amine has a molecular weight of 174.20 g/mol, XLogP of 2.38, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-4-phenyl-1,2-oxazol-5-amine is sourced from PubChem (CID 118895094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).