About methyl 7-[2-[(E)-4,4-difluoro-3-hydroxynon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate
methyl 7-[2-[(E)-4,4-difluoro-3-hydroxynon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate (PubChem CID 118896801) has the molecular formula C21H31F2NO4
and a molecular weight of 399.48 g/mol. Its IUPAC name is methyl 7-[2-[(E)-4,4-difluoro-3-hydroxynon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate.
Molecular Properties
| Compound Name | methyl 7-[2-[(E)-4,4-difluoro-3-hydroxynon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate |
| PubChem CID | 118896801 |
| Molecular Formula | C21H31F2NO4 |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | methyl 7-[2-[(E)-4,4-difluoro-3-hydroxynon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate |
| SMILES | CCC#CCC(F)(F)C(O)/C=C/C1CCC(=O)N1CCCCCCC(=O)OC |
| InChI | InChI=1S/C21H31F2NO4/c1-3-4-8-15-21(22,23)18(25)13-11-17-12-14-19(26)24(17)16-9-6-5-7-10-20(27)28-2/h11,13,17-18,25H,3,5-7,9-10,12,14-16H2,1-2H3/b13-11+ |
| InChIKey | GWSXPSKJHVHHLX-ACCUITESSA-N |
| XLogP | 3.46 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-[2-[(E)-4,4-difluoro-3-hydroxynon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-[2-[(E)-4,4-difluoro-3-hydroxynon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate?
The IUPAC name of methyl 7-[2-[(E)-4,4-difluoro-3-hydroxynon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate (CID 118896801) is methyl 7-[2-[(E)-4,4-difluoro-3-hydroxynon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate.
What is the SMILES notation for methyl 7-[2-[(E)-4,4-difluoro-3-hydroxynon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate?
The canonical SMILES for methyl 7-[2-[(E)-4,4-difluoro-3-hydroxynon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate is CCC#CCC(F)(F)C(O)/C=C/C1CCC(=O)N1CCCCCCC(=O)OC.
What is the InChIKey of methyl 7-[2-[(E)-4,4-difluoro-3-hydroxynon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate?
The InChIKey is GWSXPSKJHVHHLX-ACCUITESSA-N. The full InChI is InChI=1S/C21H31F2NO4/c1-3-4-8-15-21(22,23)18(25)13-11-17-12-14-19(26)24(17)16-9-6-5-7-10-20(27)28-2/h11,13,17-18,25H,3,5-7,9-10,12,14-16H2,1-2H3/b13-11+.
What are the key properties of methyl 7-[2-[(E)-4,4-difluoro-3-hydroxynon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate?
methyl 7-[2-[(E)-4,4-difluoro-3-hydroxynon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate has a molecular weight of 399.48 g/mol, XLogP of 3.46, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-[2-[(E)-4,4-difluoro-3-hydroxynon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate is sourced from PubChem (CID 118896801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).