C31H43F5N4O5 — CID 118897787
1-[2-[[3,5-diethoxy-4-[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]phenyl]methyl]-5-oxa-2,6-diazaspiro[3.4]oct-6-en-7-yl]-4-methylpiperidine-4-carboxylic acid (PubChem CID 118897787) has the molecular formula C31H43F5N4O5 and a molecular weight of 646.70 g/mol. Its IUPAC name is 1-[2-[[3,5-diethoxy-4-[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]phenyl]methyl]-5-oxa-2,6-diazaspiro[3.4]oct-6-en-7-yl]-4-methylpiperidine-4-carboxylic acid.
| Compound Name | 1-[2-[[3,5-diethoxy-4-[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]phenyl]methyl]-5-oxa-2,6-diazaspiro[3.4]oct-6-en-7-yl]-4-methylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 118897787 |
| Molecular Formula | C31H43F5N4O5 |
| Molecular Weight | 646.70 g/mol |
| Exact Mass | 646.32 |
| IUPAC Name | 1-[2-[[3,5-diethoxy-4-[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]phenyl]methyl]-5-oxa-2,6-diazaspiro[3.4]oct-6-en-7-yl]-4-methylpiperidine-4-carboxylic acid |
| SMILES | CCOc1cc(CN2CC3(CC(N4CCC(C)(C(=O)O)CC4)=NO3)C2)cc(OCC)c1C1CCN(CC(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C31H43F5N4O5/c1-4-43-23-14-21(15-24(44-5-2)26(23)22-6-10-38(11-7-22)20-30(32,33)31(34,35)36)17-39-18-29(19-39)16-25(37-45-29)40-12-8-28(3,9-13-40)27(41)42/h14-15,22H,4-13,16-20H2,1-3H3,(H,41,42) |
| InChIKey | BRDOWOMXQMGRLX-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.70 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|