C16H18N3O5+ — CID 11889787
methyl (1'S,3R,8'R)-5-nitro-2-oxospiro[1H-indole-3,3'-2,4,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium]-1'-carboxylate (PubChem CID 11889787) has the molecular formula C16H18N3O5+ and a molecular weight of 332.34 g/mol. Its IUPAC name is methyl (1'S,3R,8'R)-5-nitro-2-oxospiro[1H-indole-3,3'-2,4,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium]-1'-carboxylate.
| Compound Name | methyl (1'S,3R,8'R)-5-nitro-2-oxospiro[1H-indole-3,3'-2,4,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium]-1'-carboxylate |
|---|---|
| PubChem CID | 11889787 |
| Molecular Formula | C16H18N3O5+ |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | methyl (1'S,3R,8'R)-5-nitro-2-oxospiro[1H-indole-3,3'-2,4,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium]-1'-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@]2(C(=O)Nc3ccc([N+](=O)[O-])cc32)[NH+]2CCC[C@H]12 |
| InChI | InChI=1S/C16H17N3O5/c1-24-14(20)10-8-16(18-6-2-3-13(10)18)11-7-9(19(22)23)4-5-12(11)17-15(16)21/h4-5,7,10,13H,2-3,6,8H2,1H3,(H,17,21)/p+1/t10-,13+,16+/m0/s1 |
| InChIKey | INMSNIOAXIMXNT-OWRWGESLSA-O |
| XLogP | -0.02 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|