About heptan-3-one;propane-1,2-diol
heptan-3-one;propane-1,2-diol (PubChem CID 118898298) has the molecular formula C10H22O3
and a molecular weight of 190.28 g/mol. Its IUPAC name is heptan-3-one;propane-1,2-diol.
Molecular Properties
| Compound Name | heptan-3-one;propane-1,2-diol |
| PubChem CID | 118898298 |
| Molecular Formula | C10H22O3 |
| Molecular Weight | 190.28 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | heptan-3-one;propane-1,2-diol |
| SMILES | CC(O)CO.CCCCC(=O)CC |
| InChI | InChI=1S/C7H14O.C3H8O2/c1-3-5-6-7(8)4-2;1-3(5)2-4/h3-6H2,1-2H3;3-5H,2H2,1H3 |
| InChIKey | SIBMVPZXXFOYQL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze heptan-3-one;propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptan-3-one;propane-1,2-diol?
The IUPAC name of heptan-3-one;propane-1,2-diol (CID 118898298) is heptan-3-one;propane-1,2-diol.
What is the SMILES notation for heptan-3-one;propane-1,2-diol?
The canonical SMILES for heptan-3-one;propane-1,2-diol is CC(O)CO.CCCCC(=O)CC.
What is the InChIKey of heptan-3-one;propane-1,2-diol?
The InChIKey is SIBMVPZXXFOYQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.C3H8O2/c1-3-5-6-7(8)4-2;1-3(5)2-4/h3-6H2,1-2H3;3-5H,2H2,1H3.
What are the key properties of heptan-3-one;propane-1,2-diol?
heptan-3-one;propane-1,2-diol has a molecular weight of 190.28 g/mol, XLogP of 1.52, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for heptan-3-one;propane-1,2-diol is sourced from PubChem (CID 118898298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).