About 6-bromo-5,6-dihydro-1H-indole
6-bromo-5,6-dihydro-1H-indole (PubChem CID 118899465) has the molecular formula C8H8BrN
and a molecular weight of 198.06 g/mol. Its IUPAC name is 6-bromo-5,6-dihydro-1H-indole.
Molecular Properties
| Compound Name | 6-bromo-5,6-dihydro-1H-indole |
| PubChem CID | 118899465 |
| Molecular Formula | C8H8BrN |
| Molecular Weight | 198.06 g/mol |
| Exact Mass | 196.98 |
| IUPAC Name | 6-bromo-5,6-dihydro-1H-indole |
| SMILES | BrC1C=c2[nH]ccc2=CC1 |
| InChI | InChI=1S/C8H8BrN/c9-7-2-1-6-3-4-10-8(6)5-7/h1,3-5,7,10H,2H2 |
| InChIKey | LRNCOQBHHDXJHT-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.06 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-5,6-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-5,6-dihydro-1H-indole?
The IUPAC name of 6-bromo-5,6-dihydro-1H-indole (CID 118899465) is 6-bromo-5,6-dihydro-1H-indole.
What is the SMILES notation for 6-bromo-5,6-dihydro-1H-indole?
The canonical SMILES for 6-bromo-5,6-dihydro-1H-indole is BrC1C=c2[nH]ccc2=CC1.
What is the InChIKey of 6-bromo-5,6-dihydro-1H-indole?
The InChIKey is LRNCOQBHHDXJHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrN/c9-7-2-1-6-3-4-10-8(6)5-7/h1,3-5,7,10H,2H2.
What are the key properties of 6-bromo-5,6-dihydro-1H-indole?
6-bromo-5,6-dihydro-1H-indole has a molecular weight of 198.06 g/mol, XLogP of 0.74, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-5,6-dihydro-1H-indole is sourced from PubChem (CID 118899465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).