C20H26INO2 — CID 118899914
(3S,5R)-3-[(6R)-6-[hydroxy(iodo)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-6-azaspiro[4.5]decan-7-one (PubChem CID 118899914) has the molecular formula C20H26INO2 and a molecular weight of 439.34 g/mol. Its IUPAC name is (3S,5R)-3-[(6R)-6-[hydroxy(iodo)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-6-azaspiro[4.5]decan-7-one.
| Compound Name | (3S,5R)-3-[(6R)-6-[hydroxy(iodo)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-6-azaspiro[4.5]decan-7-one |
|---|---|
| PubChem CID | 118899914 |
| Molecular Formula | C20H26INO2 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | (3S,5R)-3-[(6R)-6-[hydroxy(iodo)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-6-azaspiro[4.5]decan-7-one |
| SMILES | O=C1CCC[C@]2(CC[C@H](c3ccc4c(c3)CC[C@@H](C(O)I)C4)C2)N1 |
| InChI | InChI=1S/C20H26INO2/c21-19(24)16-6-5-13-10-15(4-3-14(13)11-16)17-7-9-20(12-17)8-1-2-18(23)22-20/h3-4,10,16-17,19,24H,1-2,5-9,11-12H2,(H,22,23)/t16-,17+,19?,20-/m1/s1 |
| InChIKey | PKHNBDAZBUPUCR-HLTCZBPJSA-N |
| XLogP | 3.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|