C18H25NO — CID 118900122
4-[[(2S,4aR)-4a,5,6-trimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]oxy]pyridine (PubChem CID 118900122) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is 4-[[(2S,4aR)-4a,5,6-trimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]oxy]pyridine.
| Compound Name | 4-[[(2S,4aR)-4a,5,6-trimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]oxy]pyridine |
|---|---|
| PubChem CID | 118900122 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 4-[[(2S,4aR)-4a,5,6-trimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]oxy]pyridine |
| SMILES | CC1CC=C2C[C@@H](Oc3ccncc3)CC[C@]2(C)C1C |
| InChI | InChI=1S/C18H25NO/c1-13-4-5-15-12-17(6-9-18(15,3)14(13)2)20-16-7-10-19-11-8-16/h5,7-8,10-11,13-14,17H,4,6,9,12H2,1-3H3/t13?,14?,17-,18+/m0/s1 |
| InChIKey | HVKASOLAQPAVKK-JOCCRWCTSA-N |
| XLogP | 4.62 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|