C28H28F3N3O2 — CID 118900337
(7S)-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-7-propan-2-yl-6-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydropyrrolo[3,4-b]pyridine-3-carboxamide (PubChem CID 118900337) has the molecular formula C28H28F3N3O2 and a molecular weight of 495.55 g/mol. Its IUPAC name is (7S)-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-7-propan-2-yl-6-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydropyrrolo[3,4-b]pyridine-3-carboxamide.
| Compound Name | (7S)-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-7-propan-2-yl-6-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydropyrrolo[3,4-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118900337 |
| Molecular Formula | C28H28F3N3O2 |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | (7S)-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-7-propan-2-yl-6-[[4-(trifluoromethyl)phenyl]methyl]-5,7-dihydropyrrolo[3,4-b]pyridine-3-carboxamide |
| SMILES | CC(C)[C@H]1c2ncc(C(=O)N[C@@H]3c4ccccc4C[C@@H]3O)cc2CN1Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H28F3N3O2/c1-16(2)26-24-20(15-34(26)14-17-7-9-21(10-8-17)28(29,30)31)11-19(13-32-24)27(36)33-25-22-6-4-3-5-18(22)12-23(25)35/h3-11,13,16,23,25-26,35H,12,14-15H2,1-2H3,(H,33,36)/t23-,25+,26-/m0/s1 |
| InChIKey | BESHYTMQYZRFHG-DMDYGQEQSA-N |
| XLogP | 5.20 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |