C25H20ClF3N4O6 — CID 118900376
3-[5-[(5-chloro-2-pyridinyl)-hydroxymethyl]-1-methyl-2,4-dioxo-6-[3-(trifluoromethoxy)phenyl]pyrido[2,3-d]pyrimidin-3-yl]propyl formate (PubChem CID 118900376) has the molecular formula C25H20ClF3N4O6 and a molecular weight of 564.90 g/mol. Its IUPAC name is 3-[5-[(5-chloro-2-pyridinyl)-hydroxymethyl]-1-methyl-2,4-dioxo-6-[3-(trifluoromethoxy)phenyl]pyrido[2,3-d]pyrimidin-3-yl]propyl formate.
| Compound Name | 3-[5-[(5-chloro-2-pyridinyl)-hydroxymethyl]-1-methyl-2,4-dioxo-6-[3-(trifluoromethoxy)phenyl]pyrido[2,3-d]pyrimidin-3-yl]propyl formate |
|---|---|
| PubChem CID | 118900376 |
| Molecular Formula | C25H20ClF3N4O6 |
| Molecular Weight | 564.90 g/mol |
| Exact Mass | 564.10 |
| IUPAC Name | 3-[5-[(5-chloro-2-pyridinyl)-hydroxymethyl]-1-methyl-2,4-dioxo-6-[3-(trifluoromethoxy)phenyl]pyrido[2,3-d]pyrimidin-3-yl]propyl formate |
| SMILES | Cn1c(=O)n(CCCOC=O)c(=O)c2c(C(O)c3ccc(Cl)cn3)c(-c3cccc(OC(F)(F)F)c3)cnc21 |
| InChI | InChI=1S/C25H20ClF3N4O6/c1-32-22-20(23(36)33(24(32)37)8-3-9-38-13-34)19(21(35)18-7-6-15(26)11-30-18)17(12-31-22)14-4-2-5-16(10-14)39-25(27,28)29/h2,4-7,10-13,21,35H,3,8-9H2,1H3 |
| InChIKey | QATKWHKIYOXMHT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.90 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|