C22H16F3N4O+ — CID 11890058
(2R,3R,10bS)-1,1-dicyano-2-[2-(trifluoromethyl)phenyl]-2,3,4,10b-tetrahydropyrrolo[2,1-a]isoquinolin-4-ium-3-carboxamide (PubChem CID 11890058) has the molecular formula C22H16F3N4O+ and a molecular weight of 409.39 g/mol. Its IUPAC name is (2R,3R,10bS)-1,1-dicyano-2-[2-(trifluoromethyl)phenyl]-2,3,4,10b-tetrahydropyrrolo[2,1-a]isoquinolin-4-ium-3-carboxamide.
| Compound Name | (2R,3R,10bS)-1,1-dicyano-2-[2-(trifluoromethyl)phenyl]-2,3,4,10b-tetrahydropyrrolo[2,1-a]isoquinolin-4-ium-3-carboxamide |
|---|---|
| PubChem CID | 11890058 |
| Molecular Formula | C22H16F3N4O+ |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | (2R,3R,10bS)-1,1-dicyano-2-[2-(trifluoromethyl)phenyl]-2,3,4,10b-tetrahydropyrrolo[2,1-a]isoquinolin-4-ium-3-carboxamide |
| SMILES | N#CC1(C#N)[C@@H]2c3ccccc3C=C[NH+]2[C@@H](C(N)=O)[C@@H]1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C22H15F3N4O/c23-22(24,25)16-8-4-3-7-15(16)17-18(20(28)30)29-10-9-13-5-1-2-6-14(13)19(29)21(17,11-26)12-27/h1-10,17-19H,(H2,28,30)/p+1/t17-,18+,19-/m0/s1 |
| InChIKey | VXULVLQTVMTHOA-OTWHNJEPSA-O |
| XLogP | 2.30 |
| TPSA | 95.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |