C14H24O8 — CID 118900715
[(3S,4R,5R,6R)-2-acetyloxy-4-butoxy-5-hydroxy-6-(hydroxymethyl)oxan-3-yl] acetate (PubChem CID 118900715) has the molecular formula C14H24O8 and a molecular weight of 320.34 g/mol. Its IUPAC name is [(3S,4R,5R,6R)-2-acetyloxy-4-butoxy-5-hydroxy-6-(hydroxymethyl)oxan-3-yl] acetate.
| Compound Name | [(3S,4R,5R,6R)-2-acetyloxy-4-butoxy-5-hydroxy-6-(hydroxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 118900715 |
| Molecular Formula | C14H24O8 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | [(3S,4R,5R,6R)-2-acetyloxy-4-butoxy-5-hydroxy-6-(hydroxymethyl)oxan-3-yl] acetate |
| SMILES | CCCCO[C@@H]1[C@H](O)[C@@H](CO)OC(OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C14H24O8/c1-4-5-6-19-12-11(18)10(7-15)22-14(21-9(3)17)13(12)20-8(2)16/h10-15,18H,4-7H2,1-3H3/t10-,11-,12-,13+,14?/m1/s1 |
| InChIKey | HCAMGCOPLRQHFI-LSGALXMHSA-N |
| XLogP | -0.26 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|