C22H21F7O — CID 118900731
1-[difluoro-[(2E,4E,7Z,9Z)-5,7,8-trifluoro-6-methylideneundeca-2,4,7,9-tetraen-3-yl]oxymethyl]-2,3-difluoro-4-propylbenzene (PubChem CID 118900731) has the molecular formula C22H21F7O and a molecular weight of 434.40 g/mol. Its IUPAC name is 1-[difluoro-[(2E,4E,7Z,9Z)-5,7,8-trifluoro-6-methylideneundeca-2,4,7,9-tetraen-3-yl]oxymethyl]-2,3-difluoro-4-propylbenzene.
| Compound Name | 1-[difluoro-[(2E,4E,7Z,9Z)-5,7,8-trifluoro-6-methylideneundeca-2,4,7,9-tetraen-3-yl]oxymethyl]-2,3-difluoro-4-propylbenzene |
|---|---|
| PubChem CID | 118900731 |
| Molecular Formula | C22H21F7O |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 1-[difluoro-[(2E,4E,7Z,9Z)-5,7,8-trifluoro-6-methylideneundeca-2,4,7,9-tetraen-3-yl]oxymethyl]-2,3-difluoro-4-propylbenzene |
| SMILES | C=C(/C(F)=C/C(=C\C)OC(F)(F)c1ccc(CCC)c(F)c1F)/C(F)=C(F)\C=C/C |
| InChI | InChI=1S/C22H21F7O/c1-5-8-14-10-11-16(21(27)20(14)26)22(28,29)30-15(7-3)12-18(24)13(4)19(25)17(23)9-6-2/h6-7,9-12H,4-5,8H2,1-3H3/b9-6-,15-7-,18-12+,19-17- |
| InChIKey | OWVFXJMUNVWMLA-OQSQNKMBSA-N |
| XLogP | 8.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|