C18H14F8N4O3S — CID 118900946
2-[3-ethylsulfonyl-5-(1,1,2,2,2-pentafluoroethyl)-2-pyridinyl]-3,5-dimethyl-6-(trifluoromethyl)imidazo[4,5-c]pyridin-4-one (PubChem CID 118900946) has the molecular formula C18H14F8N4O3S and a molecular weight of 518.39 g/mol. Its IUPAC name is 2-[3-ethylsulfonyl-5-(1,1,2,2,2-pentafluoroethyl)-2-pyridinyl]-3,5-dimethyl-6-(trifluoromethyl)imidazo[4,5-c]pyridin-4-one.
| Compound Name | 2-[3-ethylsulfonyl-5-(1,1,2,2,2-pentafluoroethyl)-2-pyridinyl]-3,5-dimethyl-6-(trifluoromethyl)imidazo[4,5-c]pyridin-4-one |
|---|---|
| PubChem CID | 118900946 |
| Molecular Formula | C18H14F8N4O3S |
| Molecular Weight | 518.39 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | 2-[3-ethylsulfonyl-5-(1,1,2,2,2-pentafluoroethyl)-2-pyridinyl]-3,5-dimethyl-6-(trifluoromethyl)imidazo[4,5-c]pyridin-4-one |
| SMILES | CCS(=O)(=O)c1cc(C(F)(F)C(F)(F)F)cnc1-c1nc2cc(C(F)(F)F)n(C)c(=O)c2n1C |
| InChI | InChI=1S/C18H14F8N4O3S/c1-4-34(32,33)10-5-8(16(19,20)18(24,25)26)7-27-12(10)14-28-9-6-11(17(21,22)23)29(2)15(31)13(9)30(14)3/h5-7H,4H2,1-3H3 |
| InChIKey | DJXFOJJVGZINCJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 86.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|