C9H14F3N3O — CID 118900963
(2Z)-3-amino-N-methyl-2-(methylamino)-N-(2,2,2-trifluoroethyl)penta-2,4-dienamide (PubChem CID 118900963) has the molecular formula C9H14F3N3O and a molecular weight of 237.22 g/mol. Its IUPAC name is (2Z)-3-amino-N-methyl-2-(methylamino)-N-(2,2,2-trifluoroethyl)penta-2,4-dienamide.
| Compound Name | (2Z)-3-amino-N-methyl-2-(methylamino)-N-(2,2,2-trifluoroethyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 118900963 |
| Molecular Formula | C9H14F3N3O |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | (2Z)-3-amino-N-methyl-2-(methylamino)-N-(2,2,2-trifluoroethyl)penta-2,4-dienamide |
| SMILES | C=C/C(N)=C(/NC)C(=O)N(C)CC(F)(F)F |
| InChI | InChI=1S/C9H14F3N3O/c1-4-6(13)7(14-2)8(16)15(3)5-9(10,11)12/h4,14H,1,5,13H2,2-3H3/b7-6- |
| InChIKey | SWJJJMGDXPEBRK-SREVYHEPSA-N |
| XLogP | 0.58 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|