C8H12N2 — CID 118901349
(3Z,5Z)-octa-3,5-diene-1,8-diimine (PubChem CID 118901349) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is (3Z,5Z)-octa-3,5-diene-1,8-diimine.
| Compound Name | (3Z,5Z)-octa-3,5-diene-1,8-diimine |
|---|---|
| PubChem CID | 118901349 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (3Z,5Z)-octa-3,5-diene-1,8-diimine |
| SMILES | [H]/N=C/C/C=C\C=C/C/C=N/[H] |
| InChI | InChI=1S/C8H12N2/c9-7-5-3-1-2-4-6-8-10/h1-4,7-10H,5-6H2/b3-1-,4-2-,9-7+,10-8+ |
| InChIKey | VZKIDSHAQAOABK-ACJGFMQPSA-N |
| XLogP | 2.18 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|