C9H14N2 — CID 118901632
(3Z,5Z)-N'-ethylidenehepta-3,5-diene-1,7-diimine (PubChem CID 118901632) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is (3Z,5Z)-N'-ethylidenehepta-3,5-diene-1,7-diimine.
| Compound Name | (3Z,5Z)-N'-ethylidenehepta-3,5-diene-1,7-diimine |
|---|---|
| PubChem CID | 118901632 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (3Z,5Z)-N'-ethylidenehepta-3,5-diene-1,7-diimine |
| SMILES | [H]/N=C/C/C=C\C=C/C/N=C/C |
| InChI | InChI=1S/C9H14N2/c1-2-11-9-7-5-3-4-6-8-10/h2-5,7-8,10H,6,9H2,1H3/b4-3-,7-5-,10-8+,11-2+ |
| InChIKey | UUCTVXQCFCWQGO-KACRTGKDSA-N |
| XLogP | 2.23 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|