About (4E,5E)-5-ethylidene-4-prop-2-enylidene-1,3-oxazole
(4E,5E)-5-ethylidene-4-prop-2-enylidene-1,3-oxazole (PubChem CID 118901633) has the molecular formula C8H9NO
and a molecular weight of 135.17 g/mol. Its IUPAC name is (4E,5E)-5-ethylidene-4-prop-2-enylidene-1,3-oxazole.
Molecular Properties
| Compound Name | (4E,5E)-5-ethylidene-4-prop-2-enylidene-1,3-oxazole |
| PubChem CID | 118901633 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | (4E,5E)-5-ethylidene-4-prop-2-enylidene-1,3-oxazole |
| SMILES | C=C/C=c1/nco/c1=C/C |
| InChI | InChI=1S/C8H9NO/c1-3-5-7-8(4-2)10-6-9-7/h3-6H,1H2,2H3/b7-5+,8-4+ |
| InChIKey | WRZGLDYEFXKQON-JBVHCYJISA-N |
| XLogP | 0.44 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4E,5E)-5-ethylidene-4-prop-2-enylidene-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5E)-5-ethylidene-4-prop-2-enylidene-1,3-oxazole?
The IUPAC name of (4E,5E)-5-ethylidene-4-prop-2-enylidene-1,3-oxazole (CID 118901633) is (4E,5E)-5-ethylidene-4-prop-2-enylidene-1,3-oxazole.
What is the SMILES notation for (4E,5E)-5-ethylidene-4-prop-2-enylidene-1,3-oxazole?
The canonical SMILES for (4E,5E)-5-ethylidene-4-prop-2-enylidene-1,3-oxazole is C=C/C=c1/nco/c1=C/C.
What is the InChIKey of (4E,5E)-5-ethylidene-4-prop-2-enylidene-1,3-oxazole?
The InChIKey is WRZGLDYEFXKQON-JBVHCYJISA-N. The full InChI is InChI=1S/C8H9NO/c1-3-5-7-8(4-2)10-6-9-7/h3-6H,1H2,2H3/b7-5+,8-4+.
What are the key properties of (4E,5E)-5-ethylidene-4-prop-2-enylidene-1,3-oxazole?
(4E,5E)-5-ethylidene-4-prop-2-enylidene-1,3-oxazole has a molecular weight of 135.17 g/mol, XLogP of 0.44, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5E)-5-ethylidene-4-prop-2-enylidene-1,3-oxazole is sourced from PubChem (CID 118901633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).