C10H19NO2S — CID 118901664
1-tert-butyl-2,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrole 5,5-dioxide (PubChem CID 118901664) has the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. Its IUPAC name is 1-tert-butyl-2,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrole 5,5-dioxide.
| Compound Name | 1-tert-butyl-2,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrole 5,5-dioxide |
|---|---|
| PubChem CID | 118901664 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 1-tert-butyl-2,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrole 5,5-dioxide |
| SMILES | CC(C)(C)N1CCC2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C10H19NO2S/c1-10(2,3)11-5-4-8-6-14(12,13)7-9(8)11/h8-9H,4-7H2,1-3H3 |
| InChIKey | BBQKEDISWOWEFJ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |