C12H23FN2 — CID 118901673
6-tert-butyl-4-fluoro-1-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine (PubChem CID 118901673) has the molecular formula C12H23FN2 and a molecular weight of 214.33 g/mol. Its IUPAC name is 6-tert-butyl-4-fluoro-1-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine.
| Compound Name | 6-tert-butyl-4-fluoro-1-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 118901673 |
| Molecular Formula | C12H23FN2 |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 6-tert-butyl-4-fluoro-1-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine |
| SMILES | CN1CCC(F)C2CN(C(C)(C)C)CC21 |
| InChI | InChI=1S/C12H23FN2/c1-12(2,3)15-7-9-10(13)5-6-14(4)11(9)8-15/h9-11H,5-8H2,1-4H3 |
| InChIKey | WXMYBAPYQVWJHN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |