About 4-(2,2-dideuterio-4,4-dimethylpentyl)oxane
4-(2,2-dideuterio-4,4-dimethylpentyl)oxane (PubChem CID 118901717) has the molecular formula C12H24O
and a molecular weight of 186.34 g/mol. Its IUPAC name is 4-(2,2-dideuterio-4,4-dimethylpentyl)oxane.
Molecular Properties
| Compound Name | 4-(2,2-dideuterio-4,4-dimethylpentyl)oxane |
| PubChem CID | 118901717 |
| Molecular Formula | C12H24O |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.20 |
| IUPAC Name | 4-(2,2-dideuterio-4,4-dimethylpentyl)oxane |
| SMILES | [2H]C([2H])(CC1CCOCC1)CC(C)(C)C |
| InChI | InChI=1S/C12H24O/c1-12(2,3)8-4-5-11-6-9-13-10-7-11/h11H,4-10H2,1-3H3/i4D2 |
| InChIKey | MVIHINVAQRWNLU-APZFVMQVSA-N |
| XLogP | 3.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(2,2-dideuterio-4,4-dimethylpentyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-dideuterio-4,4-dimethylpentyl)oxane?
The IUPAC name of 4-(2,2-dideuterio-4,4-dimethylpentyl)oxane (CID 118901717) is 4-(2,2-dideuterio-4,4-dimethylpentyl)oxane.
What is the SMILES notation for 4-(2,2-dideuterio-4,4-dimethylpentyl)oxane?
The canonical SMILES for 4-(2,2-dideuterio-4,4-dimethylpentyl)oxane is [2H]C([2H])(CC1CCOCC1)CC(C)(C)C.
What is the InChIKey of 4-(2,2-dideuterio-4,4-dimethylpentyl)oxane?
The InChIKey is MVIHINVAQRWNLU-APZFVMQVSA-N. The full InChI is InChI=1S/C12H24O/c1-12(2,3)8-4-5-11-6-9-13-10-7-11/h11H,4-10H2,1-3H3/i4D2.
What are the key properties of 4-(2,2-dideuterio-4,4-dimethylpentyl)oxane?
4-(2,2-dideuterio-4,4-dimethylpentyl)oxane has a molecular weight of 186.34 g/mol, XLogP of 3.63, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dideuterio-4,4-dimethylpentyl)oxane is sourced from PubChem (CID 118901717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).