C12H24O — CID 118901717
4-(2,2-dideuterio-4,4-dimethylpentyl)oxane (PubChem CID 118901717) has the molecular formula C12H24O and a molecular weight of 186.34 g/mol. Its IUPAC name is 4-(2,2-dideuterio-4,4-dimethylpentyl)oxane.
| Compound Name | 4-(2,2-dideuterio-4,4-dimethylpentyl)oxane |
|---|---|
| PubChem CID | 118901717 |
| Molecular Formula | C12H24O |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.20 |
| IUPAC Name | 4-(2,2-dideuterio-4,4-dimethylpentyl)oxane |
| SMILES | [2H]C([2H])(CC1CCOCC1)CC(C)(C)C |
| InChI | InChI=1S/C12H24O/c1-12(2,3)8-4-5-11-6-9-13-10-7-11/h11H,4-10H2,1-3H3/i4D2 |
| InChIKey | MVIHINVAQRWNLU-APZFVMQVSA-N |
| XLogP | 3.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |