About 6-(3,3-dimethylbut-1-ynyl)-3-methyl-3-azabicyclo[3.1.0]hexane
6-(3,3-dimethylbut-1-ynyl)-3-methyl-3-azabicyclo[3.1.0]hexane (PubChem CID 118901732) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is 6-(3,3-dimethylbut-1-ynyl)-3-methyl-3-azabicyclo[3.1.0]hexane.
Molecular Properties
| Compound Name | 6-(3,3-dimethylbut-1-ynyl)-3-methyl-3-azabicyclo[3.1.0]hexane |
| PubChem CID | 118901732 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 6-(3,3-dimethylbut-1-ynyl)-3-methyl-3-azabicyclo[3.1.0]hexane |
| SMILES | CN1CC2C(C#CC(C)(C)C)C2C1 |
| InChI | InChI=1S/C12H19N/c1-12(2,3)6-5-9-10-7-13(4)8-11(9)10/h9-11H,7-8H2,1-4H3 |
| InChIKey | LCURXAKZGHJTGS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(3,3-dimethylbut-1-ynyl)-3-methyl-3-azabicyclo[3.1.0]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,3-dimethylbut-1-ynyl)-3-methyl-3-azabicyclo[3.1.0]hexane?
The IUPAC name of 6-(3,3-dimethylbut-1-ynyl)-3-methyl-3-azabicyclo[3.1.0]hexane (CID 118901732) is 6-(3,3-dimethylbut-1-ynyl)-3-methyl-3-azabicyclo[3.1.0]hexane.
What is the SMILES notation for 6-(3,3-dimethylbut-1-ynyl)-3-methyl-3-azabicyclo[3.1.0]hexane?
The canonical SMILES for 6-(3,3-dimethylbut-1-ynyl)-3-methyl-3-azabicyclo[3.1.0]hexane is CN1CC2C(C#CC(C)(C)C)C2C1.
What is the InChIKey of 6-(3,3-dimethylbut-1-ynyl)-3-methyl-3-azabicyclo[3.1.0]hexane?
The InChIKey is LCURXAKZGHJTGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N/c1-12(2,3)6-5-9-10-7-13(4)8-11(9)10/h9-11H,7-8H2,1-4H3.
What are the key properties of 6-(3,3-dimethylbut-1-ynyl)-3-methyl-3-azabicyclo[3.1.0]hexane?
6-(3,3-dimethylbut-1-ynyl)-3-methyl-3-azabicyclo[3.1.0]hexane has a molecular weight of 177.29 g/mol, XLogP of 1.84, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,3-dimethylbut-1-ynyl)-3-methyl-3-azabicyclo[3.1.0]hexane is sourced from PubChem (CID 118901732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).