C22H23N5O3 — CID 118901801
N-[3-[1,2-oxazol-4-ylmethyl(2H-pyrrol-4-ylmethyl)amino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 118901801) has the molecular formula C22H23N5O3 and a molecular weight of 405.46 g/mol. Its IUPAC name is N-[3-[1,2-oxazol-4-ylmethyl(2H-pyrrol-4-ylmethyl)amino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[3-[1,2-oxazol-4-ylmethyl(2H-pyrrol-4-ylmethyl)amino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 118901801 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | N-[3-[1,2-oxazol-4-ylmethyl(2H-pyrrol-4-ylmethyl)amino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCCN(CC1=CCN=C1)Cc1cnoc1)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C22H23N5O3/c28-22(20-11-21(30-26-20)19-5-2-1-3-6-19)24-8-4-10-27(14-17-7-9-23-12-17)15-18-13-25-29-16-18/h1-3,5-7,11-13,16H,4,8-10,14-15H2,(H,24,28) |
| InChIKey | KVZJYRGQUFLJDF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|