C16H18N4O3S — CID 118901818
N-[3-[(2-methyl-1,3-oxazol-5-yl)methylamino]propyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide (PubChem CID 118901818) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is N-[3-[(2-methyl-1,3-oxazol-5-yl)methylamino]propyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[3-[(2-methyl-1,3-oxazol-5-yl)methylamino]propyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 118901818 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-[3-[(2-methyl-1,3-oxazol-5-yl)methylamino]propyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1ncc(CNCCCNC(=O)c2cc(-c3cccs3)on2)o1 |
| InChI | InChI=1S/C16H18N4O3S/c1-11-19-10-12(22-11)9-17-5-3-6-18-16(21)13-8-14(23-20-13)15-4-2-7-24-15/h2,4,7-8,10,17H,3,5-6,9H2,1H3,(H,18,21) |
| InChIKey | LOQXXRXLKBKEMU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|