C27H31F6NO4 — CID 118901908
(5,5,6,6-tetrafluorospiro[1,3-dioxepane-2,4'-adamantane]-1'-yl) 3-[(4-ethenylphenyl)methyl-methylamino]-2,2-difluoropropanoate (PubChem CID 118901908) has the molecular formula C27H31F6NO4 and a molecular weight of 547.54 g/mol. Its IUPAC name is (5,5,6,6-tetrafluorospiro[1,3-dioxepane-2,4'-adamantane]-1'-yl) 3-[(4-ethenylphenyl)methyl-methylamino]-2,2-difluoropropanoate.
| Compound Name | (5,5,6,6-tetrafluorospiro[1,3-dioxepane-2,4'-adamantane]-1'-yl) 3-[(4-ethenylphenyl)methyl-methylamino]-2,2-difluoropropanoate |
|---|---|
| PubChem CID | 118901908 |
| Molecular Formula | C27H31F6NO4 |
| Molecular Weight | 547.54 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | (5,5,6,6-tetrafluorospiro[1,3-dioxepane-2,4'-adamantane]-1'-yl) 3-[(4-ethenylphenyl)methyl-methylamino]-2,2-difluoropropanoate |
| SMILES | C=Cc1ccc(CN(C)CC(F)(F)C(=O)OC23CC4CC(C2)C2(OCC(F)(F)C(F)(F)CO2)C(C4)C3)cc1 |
| InChI | InChI=1S/C27H31F6NO4/c1-3-17-4-6-18(7-5-17)13-34(2)14-24(28,29)22(35)38-23-10-19-8-20(11-23)27(21(9-19)12-23)36-15-25(30,31)26(32,33)16-37-27/h3-7,19-21H,1,8-16H2,2H3 |
| InChIKey | ICYBCSFXBCPPCU-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|