C18H19NO3S — CID 118902140
2-[[3-[4-(1-hydroxycyclopropyl)phenyl]-4-pyridinyl]sulfanyl]-2-methylpropanoic acid (PubChem CID 118902140) has the molecular formula C18H19NO3S and a molecular weight of 329.42 g/mol. Its IUPAC name is 2-[[3-[4-(1-hydroxycyclopropyl)phenyl]-4-pyridinyl]sulfanyl]-2-methylpropanoic acid.
| Compound Name | 2-[[3-[4-(1-hydroxycyclopropyl)phenyl]-4-pyridinyl]sulfanyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 118902140 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-[[3-[4-(1-hydroxycyclopropyl)phenyl]-4-pyridinyl]sulfanyl]-2-methylpropanoic acid |
| SMILES | CC(C)(Sc1ccncc1-c1ccc(C2(O)CC2)cc1)C(=O)O |
| InChI | InChI=1S/C18H19NO3S/c1-17(2,16(20)21)23-15-7-10-19-11-14(15)12-3-5-13(6-4-12)18(22)8-9-18/h3-7,10-11,22H,8-9H2,1-2H3,(H,20,21) |
| InChIKey | AFSXWBKRSFAWAC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |