C27H34F2N2O3 — CID 118902395
ethyl 4-(2,4-difluorophenyl)-7-[(2,2-dimethyloxan-4-yl)methyl]-8,8-dimethyl-5,6-dihydro-1,7-naphthyridine-2-carboxylate (PubChem CID 118902395) has the molecular formula C27H34F2N2O3 and a molecular weight of 472.58 g/mol. Its IUPAC name is ethyl 4-(2,4-difluorophenyl)-7-[(2,2-dimethyloxan-4-yl)methyl]-8,8-dimethyl-5,6-dihydro-1,7-naphthyridine-2-carboxylate.
| Compound Name | ethyl 4-(2,4-difluorophenyl)-7-[(2,2-dimethyloxan-4-yl)methyl]-8,8-dimethyl-5,6-dihydro-1,7-naphthyridine-2-carboxylate |
|---|---|
| PubChem CID | 118902395 |
| Molecular Formula | C27H34F2N2O3 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | ethyl 4-(2,4-difluorophenyl)-7-[(2,2-dimethyloxan-4-yl)methyl]-8,8-dimethyl-5,6-dihydro-1,7-naphthyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(F)cc2F)c2c(n1)C(C)(C)N(CC1CCOC(C)(C)C1)CC2 |
| InChI | InChI=1S/C27H34F2N2O3/c1-6-33-25(32)23-14-21(19-8-7-18(28)13-22(19)29)20-9-11-31(27(4,5)24(20)30-23)16-17-10-12-34-26(2,3)15-17/h7-8,13-14,17H,6,9-12,15-16H2,1-5H3 |
| InChIKey | NXIAXBIKQMJUFR-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |