About N-[4-[[(2S,3S)-3-fluoroazetidin-2-yl]methyl]phenyl]-2-methoxypyridine-4-carboxamide
N-[4-[[(2S,3S)-3-fluoroazetidin-2-yl]methyl]phenyl]-2-methoxypyridine-4-carboxamide (PubChem CID 118903638) has the molecular formula C17H18FN3O2
and a molecular weight of 315.35 g/mol. Its IUPAC name is N-[4-[[(2S,3S)-3-fluoroazetidin-2-yl]methyl]phenyl]-2-methoxypyridine-4-carboxamide.
Molecular Properties
| Compound Name | N-[4-[[(2S,3S)-3-fluoroazetidin-2-yl]methyl]phenyl]-2-methoxypyridine-4-carboxamide |
| PubChem CID | 118903638 |
| Molecular Formula | C17H18FN3O2 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-[4-[[(2S,3S)-3-fluoroazetidin-2-yl]methyl]phenyl]-2-methoxypyridine-4-carboxamide |
| SMILES | COc1cc(C(=O)Nc2ccc(C[C@@H]3NC[C@@H]3F)cc2)ccn1 |
| InChI | InChI=1S/C17H18FN3O2/c1-23-16-9-12(6-7-19-16)17(22)21-13-4-2-11(3-5-13)8-15-14(18)10-20-15/h2-7,9,14-15,20H,8,10H2,1H3,(H,21,22)/t14-,15-/m0/s1 |
| InChIKey | NTTRSGAMQKSXOG-GJZGRUSLSA-N |
| XLogP | 2.19 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-[[(2S,3S)-3-fluoroazetidin-2-yl]methyl]phenyl]-2-methoxypyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[[(2S,3S)-3-fluoroazetidin-2-yl]methyl]phenyl]-2-methoxypyridine-4-carboxamide?
The IUPAC name of N-[4-[[(2S,3S)-3-fluoroazetidin-2-yl]methyl]phenyl]-2-methoxypyridine-4-carboxamide (CID 118903638) is N-[4-[[(2S,3S)-3-fluoroazetidin-2-yl]methyl]phenyl]-2-methoxypyridine-4-carboxamide.
What is the SMILES notation for N-[4-[[(2S,3S)-3-fluoroazetidin-2-yl]methyl]phenyl]-2-methoxypyridine-4-carboxamide?
The canonical SMILES for N-[4-[[(2S,3S)-3-fluoroazetidin-2-yl]methyl]phenyl]-2-methoxypyridine-4-carboxamide is COc1cc(C(=O)Nc2ccc(C[C@@H]3NC[C@@H]3F)cc2)ccn1.
What is the InChIKey of N-[4-[[(2S,3S)-3-fluoroazetidin-2-yl]methyl]phenyl]-2-methoxypyridine-4-carboxamide?
The InChIKey is NTTRSGAMQKSXOG-GJZGRUSLSA-N. The full InChI is InChI=1S/C17H18FN3O2/c1-23-16-9-12(6-7-19-16)17(22)21-13-4-2-11(3-5-13)8-15-14(18)10-20-15/h2-7,9,14-15,20H,8,10H2,1H3,(H,21,22)/t14-,15-/m0/s1.
What are the key properties of N-[4-[[(2S,3S)-3-fluoroazetidin-2-yl]methyl]phenyl]-2-methoxypyridine-4-carboxamide?
N-[4-[[(2S,3S)-3-fluoroazetidin-2-yl]methyl]phenyl]-2-methoxypyridine-4-carboxamide has a molecular weight of 315.35 g/mol, XLogP of 2.19, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[[(2S,3S)-3-fluoroazetidin-2-yl]methyl]phenyl]-2-methoxypyridine-4-carboxamide is sourced from PubChem (CID 118903638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).