C26H35NO4S — CID 118903663
(2R,3R)-1-cyclopropyl-N,N-bis[(4-methoxyphenyl)methyl]-3-methylhex-5-ene-2-sulfonamide (PubChem CID 118903663) has the molecular formula C26H35NO4S and a molecular weight of 457.64 g/mol. Its IUPAC name is (2R,3R)-1-cyclopropyl-N,N-bis[(4-methoxyphenyl)methyl]-3-methylhex-5-ene-2-sulfonamide.
| Compound Name | (2R,3R)-1-cyclopropyl-N,N-bis[(4-methoxyphenyl)methyl]-3-methylhex-5-ene-2-sulfonamide |
|---|---|
| PubChem CID | 118903663 |
| Molecular Formula | C26H35NO4S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | (2R,3R)-1-cyclopropyl-N,N-bis[(4-methoxyphenyl)methyl]-3-methylhex-5-ene-2-sulfonamide |
| SMILES | C=CC[C@@H](C)[C@@H](CC1CC1)S(=O)(=O)N(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H35NO4S/c1-5-6-20(2)26(17-21-7-8-21)32(28,29)27(18-22-9-13-24(30-3)14-10-22)19-23-11-15-25(31-4)16-12-23/h5,9-16,20-21,26H,1,6-8,17-19H2,2-4H3/t20-,26-/m1/s1 |
| InChIKey | TZVPYIOAZYVQGW-FQRUVTKNSA-N |
| XLogP | 5.42 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|