C18H17NO5 — CID 118903665
2-methoxy-3-nitro-4-(1,2,3,4-tetrahydronaphthalen-1-yl)benzoic acid (PubChem CID 118903665) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-methoxy-3-nitro-4-(1,2,3,4-tetrahydronaphthalen-1-yl)benzoic acid.
| Compound Name | 2-methoxy-3-nitro-4-(1,2,3,4-tetrahydronaphthalen-1-yl)benzoic acid |
|---|---|
| PubChem CID | 118903665 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-methoxy-3-nitro-4-(1,2,3,4-tetrahydronaphthalen-1-yl)benzoic acid |
| SMILES | COc1c(C(=O)O)ccc(C2CCCc3ccccc32)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H17NO5/c1-24-17-15(18(20)21)10-9-14(16(17)19(22)23)13-8-4-6-11-5-2-3-7-12(11)13/h2-3,5,7,9-10,13H,4,6,8H2,1H3,(H,20,21) |
| InChIKey | JBHIECDRKGAYNW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|