C12H11BrF5NO2 — CID 118903672
1-[(4-bromophenyl)-difluoromethyl]azetidine;2,2,2-trifluoroacetic acid (PubChem CID 118903672) has the molecular formula C12H11BrF5NO2 and a molecular weight of 376.12 g/mol. Its IUPAC name is 1-[(4-bromophenyl)-difluoromethyl]azetidine;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(4-bromophenyl)-difluoromethyl]azetidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118903672 |
| Molecular Formula | C12H11BrF5NO2 |
| Molecular Weight | 376.12 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | 1-[(4-bromophenyl)-difluoromethyl]azetidine;2,2,2-trifluoroacetic acid |
| SMILES | FC(F)(c1ccc(Br)cc1)N1CCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H10BrF2N.C2HF3O2/c11-9-4-2-8(3-5-9)10(12,13)14-6-1-7-14;3-2(4,5)1(6)7/h2-5H,1,6-7H2;(H,6,7) |
| InChIKey | DTRKFTIKLYQCEG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.12 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|